C12H14F3N — CID 170487396
4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-en-1-amine (PubChem CID 170487396) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-en-1-amine.
| Compound Name | 4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 170487396 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-en-1-amine |
| SMILES | Cc1cc(C=CCCN)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N/c1-9-8-10(4-2-3-7-16)5-6-11(9)12(13,14)15/h2,4-6,8H,3,7,16H2,1H3 |
| InChIKey | IFPQCPLGNUPEHC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |