C12H13F3O — CID 170477031
4-[4-methyl-3-(trifluoromethyl)phenyl]but-3-en-1-ol (PubChem CID 170477031) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is 4-[4-methyl-3-(trifluoromethyl)phenyl]but-3-en-1-ol.
| Compound Name | 4-[4-methyl-3-(trifluoromethyl)phenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 170477031 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-[4-methyl-3-(trifluoromethyl)phenyl]but-3-en-1-ol |
| SMILES | Cc1ccc(C=CCCO)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3O/c1-9-5-6-10(4-2-3-7-16)8-11(9)12(13,14)15/h2,4-6,8,16H,3,7H2,1H3 |
| InChIKey | QZYPQLXGFXCQST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |