C11H14O — CID 21017863
(E)-3-(3,4-dimethylphenyl)prop-2-en-1-ol (PubChem CID 21017863) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-(3,4-dimethylphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 21017863 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (E)-3-(3,4-dimethylphenyl)prop-2-en-1-ol |
| SMILES | Cc1ccc(/C=C/CO)cc1C |
| InChI | InChI=1S/C11H14O/c1-9-5-6-11(4-3-7-12)8-10(9)2/h3-6,8,12H,7H2,1-2H3/b4-3+ |
| InChIKey | HVSPHGVXDMITFJ-ONEGZZNKSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |