C13H21N — CID 144895148
4-[(E)-but-1-enyl]-1,2-dimethylbenzene;methanamine (PubChem CID 144895148) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-[(E)-but-1-enyl]-1,2-dimethylbenzene;methanamine.
| Compound Name | 4-[(E)-but-1-enyl]-1,2-dimethylbenzene;methanamine |
|---|---|
| PubChem CID | 144895148 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-[(E)-but-1-enyl]-1,2-dimethylbenzene;methanamine |
| SMILES | CC/C=C/c1ccc(C)c(C)c1.CN |
| InChI | InChI=1S/C12H16.CH5N/c1-4-5-6-12-8-7-10(2)11(3)9-12;1-2/h5-9H,4H2,1-3H3;2H2,1H3/b6-5+; |
| InChIKey | ZYNJQOMXXWTIGO-IPZCTEOASA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |