C14H21N — CID 79592282
4-(3,4-dimethylphenyl)-N-ethylbut-3-en-1-amine (PubChem CID 79592282) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-ethylbut-3-en-1-amine.
| Compound Name | 4-(3,4-dimethylphenyl)-N-ethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79592282 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-ethylbut-3-en-1-amine |
| SMILES | CCNCCC=Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H21N/c1-4-15-10-6-5-7-14-9-8-12(2)13(3)11-14/h5,7-9,11,15H,4,6,10H2,1-3H3 |
| InChIKey | HKNCHJMXJQCDIA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|