C15H23NO2 — CID 79593408
4-(3,4-dimethoxyphenyl)-N-propylbut-3-en-1-amine (PubChem CID 79593408) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-propylbut-3-en-1-amine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79593408 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-propylbut-3-en-1-amine |
| SMILES | CCCNCCC=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO2/c1-4-10-16-11-6-5-7-13-8-9-14(17-2)15(12-13)18-3/h5,7-9,12,16H,4,6,10-11H2,1-3H3 |
| InChIKey | UYKAGKHHKDOJPB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|