C24H30O5 — CID 75041513
4-[3-[4-(3,4-dimethoxyphenyl)but-3-enoxy]but-1-enyl]-1,2-dimethoxybenzene (PubChem CID 75041513) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-[3-[4-(3,4-dimethoxyphenyl)but-3-enoxy]but-1-enyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[3-[4-(3,4-dimethoxyphenyl)but-3-enoxy]but-1-enyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 75041513 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[3-[4-(3,4-dimethoxyphenyl)but-3-enoxy]but-1-enyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(C=CCCOC(C)C=Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H30O5/c1-18(9-10-20-12-14-22(26-3)24(17-20)28-5)29-15-7-6-8-19-11-13-21(25-2)23(16-19)27-4/h6,8-14,16-18H,7,15H2,1-5H3 |
| InChIKey | RTZZXNQCBVVMGU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|