C22H26O4S2 — CID 122188364
4-[(E)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]disulfanyl]prop-1-enyl]-1,2-dimethoxybenzene (PubChem CID 122188364) has the molecular formula C22H26O4S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 4-[(E)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]disulfanyl]prop-1-enyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[(E)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]disulfanyl]prop-1-enyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 122188364 |
| Molecular Formula | C22H26O4S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[(E)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl]disulfanyl]prop-1-enyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(/C=C/CSSC/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H26O4S2/c1-23-19-11-9-17(15-21(19)25-3)7-5-13-27-28-14-6-8-18-10-12-20(24-2)22(16-18)26-4/h5-12,15-16H,13-14H2,1-4H3/b7-5+,8-6+ |
| InChIKey | NJRBLUVIWPHVPT-KQQUZDAGSA-N |
| XLogP | 5.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|