C12H16N2O2S — CID 173413865
3-(3,4-dimethoxyphenyl)prop-2-enylthiourea (PubChem CID 173413865) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)prop-2-enylthiourea.
| Compound Name | 3-(3,4-dimethoxyphenyl)prop-2-enylthiourea |
|---|---|
| PubChem CID | 173413865 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)prop-2-enylthiourea |
| SMILES | COc1ccc(C=CCNC(N)=S)cc1OC |
| InChI | InChI=1S/C12H16N2O2S/c1-15-10-6-5-9(8-11(10)16-2)4-3-7-14-12(13)17/h3-6,8H,7H2,1-2H3,(H3,13,14,17) |
| InChIKey | ZVKGLGOUSXYQLU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|