C14H19NO2 — CID 79347286
N-[3-(3,4-dimethoxyphenyl)prop-2-enyl]cyclopropanamine (PubChem CID 79347286) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)prop-2-enyl]cyclopropanamine.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 79347286 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)prop-2-enyl]cyclopropanamine |
| SMILES | COc1ccc(C=CCNC2CC2)cc1OC |
| InChI | InChI=1S/C14H19NO2/c1-16-13-8-5-11(10-14(13)17-2)4-3-9-15-12-6-7-12/h3-5,8,10,12,15H,6-7,9H2,1-2H3 |
| InChIKey | FQDGAGIPBCPWCW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |