C12H14O3 — CID 87333792
(E)-4-(3,4-dimethoxyphenyl)but-3-enal (PubChem CID 87333792) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (E)-4-(3,4-dimethoxyphenyl)but-3-enal.
| Compound Name | (E)-4-(3,4-dimethoxyphenyl)but-3-enal |
|---|---|
| PubChem CID | 87333792 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (E)-4-(3,4-dimethoxyphenyl)but-3-enal |
| SMILES | COc1ccc(/C=C/CC=O)cc1OC |
| InChI | InChI=1S/C12H14O3/c1-14-11-7-6-10(5-3-4-8-13)9-12(11)15-2/h3,5-9H,4H2,1-2H3/b5-3+ |
| InChIKey | HUYKRSXTTCOHNF-HWKANZROSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|