C13H16O2 — CID 141114401
1,2-dimethoxy-4-penta-1,3-dienylbenzene (PubChem CID 141114401) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,2-dimethoxy-4-penta-1,3-dienylbenzene.
| Compound Name | 1,2-dimethoxy-4-penta-1,3-dienylbenzene |
|---|---|
| PubChem CID | 141114401 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1,2-dimethoxy-4-penta-1,3-dienylbenzene |
| SMILES | CC=CC=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16O2/c1-4-5-6-7-11-8-9-12(14-2)13(10-11)15-3/h4-10H,1-3H3 |
| InChIKey | WSTAKHZTPMDORY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|