C13H20O2Sn — CID 10806085
[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-trimethylstannane (PubChem CID 10806085) has the molecular formula C13H20O2Sn and a molecular weight of 327.01 g/mol. Its IUPAC name is [(E)-2-(3,4-dimethoxyphenyl)ethenyl]-trimethylstannane.
| Compound Name | [(E)-2-(3,4-dimethoxyphenyl)ethenyl]-trimethylstannane |
|---|---|
| PubChem CID | 10806085 |
| Molecular Formula | C13H20O2Sn |
| Molecular Weight | 327.01 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | [(E)-2-(3,4-dimethoxyphenyl)ethenyl]-trimethylstannane |
| SMILES | COc1ccc(/C=C/[Sn](C)(C)C)cc1OC |
| InChI | InChI=1S/C10H11O2.3CH3.Sn/c1-4-8-5-6-9(11-2)10(7-8)12-3;;;;/h1,4-7H,2-3H3;3*1H3; |
| InChIKey | AHWGGCAQAJINIT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.01 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |