C28H26N2O4 — CID 5475836
2,3-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]quinoxaline (PubChem CID 5475836) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2,3-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]quinoxaline.
| Compound Name | 2,3-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]quinoxaline |
|---|---|
| PubChem CID | 5475836 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2,3-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]quinoxaline |
| SMILES | COc1ccc(/C=C/c2nc3ccccc3nc2/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H26N2O4/c1-31-25-15-11-19(17-27(25)33-3)9-13-23-24(30-22-8-6-5-7-21(22)29-23)14-10-20-12-16-26(32-2)28(18-20)34-4/h5-18H,1-4H3/b13-9+,14-10+ |
| InChIKey | MHPVIYRBVXAEQU-UTLPMFLDSA-N |
| XLogP | 6.01 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |