C11H15NO3 — CID 124638889
(E,1S)-1-amino-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol (PubChem CID 124638889) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (E,1S)-1-amino-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol.
| Compound Name | (E,1S)-1-amino-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 124638889 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (E,1S)-1-amino-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1ccc(/C=C/[C@@H](N)O)cc1OC |
| InChI | InChI=1S/C11H15NO3/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7,11,13H,12H2,1-2H3/b6-4+/t11-/m0/s1 |
| InChIKey | QJDOWZMCOUUEIQ-MALLOTDXSA-N |
| XLogP | 0.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|