C14H18O3 — CID 174881612
1-cyclopropyl-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol (PubChem CID 174881612) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol.
| Compound Name | 1-cyclopropyl-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 174881612 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-cyclopropyl-3-(3,4-dimethoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1ccc(C=CC(O)C2CC2)cc1OC |
| InChI | InChI=1S/C14H18O3/c1-16-13-8-4-10(9-14(13)17-2)3-7-12(15)11-5-6-11/h3-4,7-9,11-12,15H,5-6H2,1-2H3 |
| InChIKey | VHAPEMQHNZOTDY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |