C22H26O5 — CID 89099987
3-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenyl]cyclobutan-1-ol (PubChem CID 89099987) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenyl]cyclobutan-1-ol.
| Compound Name | 3-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 89099987 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-[4-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-2,6-dimethoxyphenyl]cyclobutan-1-ol |
| SMILES | COc1ccc(/C=C/c2cc(OC)c(C3CC(O)C3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H26O5/c1-24-18-8-7-14(9-19(18)25-2)5-6-15-10-20(26-3)22(21(11-15)27-4)16-12-17(23)13-16/h5-11,16-17,23H,12-13H2,1-4H3/b6-5+ |
| InChIKey | JZNXICBBDQQUEY-AATRIKPKSA-N |
| XLogP | 4.13 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|