C21H23NO5 — CID 46231378
N-[(1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-ylidene]hydroxylamine (PubChem CID 46231378) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[(1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-ylidene]hydroxylamine.
| Compound Name | N-[(1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 46231378 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[(1E,4E)-1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-ylidene]hydroxylamine |
| SMILES | COc1ccc(/C=C/C(/C=C/c2ccc(OC)c(OC)c2)=NO)cc1OC |
| InChI | InChI=1S/C21H23NO5/c1-24-18-11-7-15(13-20(18)26-3)5-9-17(22-23)10-6-16-8-12-19(25-2)21(14-16)27-4/h5-14,23H,1-4H3/b9-5+,10-6+ |
| InChIKey | OCGXPSRUNAQHAJ-NXZHAISVSA-N |
| XLogP | 4.28 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|