C11H13N3 — CID 150434648
4-(3-azidoprop-1-enyl)-1,2-dimethylbenzene (PubChem CID 150434648) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 4-(3-azidoprop-1-enyl)-1,2-dimethylbenzene.
| Compound Name | 4-(3-azidoprop-1-enyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 150434648 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4-(3-azidoprop-1-enyl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C=CCN=[N+]=[N-])cc1C |
| InChI | InChI=1S/C11H13N3/c1-9-5-6-11(8-10(9)2)4-3-7-13-14-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | HKMSMSVHTLHELP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|