C9H11N5 — CID 169461436
4-(3-azidoprop-1-enyl)benzene-1,2-diamine (PubChem CID 169461436) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-(3-azidoprop-1-enyl)benzene-1,2-diamine.
| Compound Name | 4-(3-azidoprop-1-enyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 169461436 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4-(3-azidoprop-1-enyl)benzene-1,2-diamine |
| SMILES | [N-]=[N+]=NCC=Cc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C9H11N5/c10-8-4-3-7(6-9(8)11)2-1-5-13-14-12/h1-4,6H,5,10-11H2 |
| InChIKey | KAOZECFYKQVKRY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|