C11H8N4O2 — CID 169462453
5-(3-azidoprop-1-enyl)isoindole-1,3-dione (PubChem CID 169462453) has the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 5-(3-azidoprop-1-enyl)isoindole-1,3-dione.
| Compound Name | 5-(3-azidoprop-1-enyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 169462453 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 5-(3-azidoprop-1-enyl)isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCC=Cc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C11H8N4O2/c12-15-13-5-1-2-7-3-4-8-9(6-7)11(17)14-10(8)16/h1-4,6H,5H2,(H,14,16,17) |
| InChIKey | HHCMCJBPEVJXQF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|