C10H7F2N3O2 — CID 169462408
5-(3-azidoprop-1-enyl)-2,2-difluoro-1,3-benzodioxole (PubChem CID 169462408) has the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. Its IUPAC name is 5-(3-azidoprop-1-enyl)-2,2-difluoro-1,3-benzodioxole.
| Compound Name | 5-(3-azidoprop-1-enyl)-2,2-difluoro-1,3-benzodioxole |
|---|---|
| PubChem CID | 169462408 |
| Molecular Formula | C10H7F2N3O2 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-(3-azidoprop-1-enyl)-2,2-difluoro-1,3-benzodioxole |
| SMILES | [N-]=[N+]=NCC=Cc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C10H7F2N3O2/c11-10(12)16-8-4-3-7(6-9(8)17-10)2-1-5-14-15-13/h1-4,6H,5H2 |
| InChIKey | FOYKWMWFQRJZBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|