C10H7ClN4S — CID 169461926
6-(3-azidoprop-1-enyl)-2-chloro-1,3-benzothiazole (PubChem CID 169461926) has the molecular formula C10H7ClN4S and a molecular weight of 250.71 g/mol. Its IUPAC name is 6-(3-azidoprop-1-enyl)-2-chloro-1,3-benzothiazole.
| Compound Name | 6-(3-azidoprop-1-enyl)-2-chloro-1,3-benzothiazole |
|---|---|
| PubChem CID | 169461926 |
| Molecular Formula | C10H7ClN4S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 6-(3-azidoprop-1-enyl)-2-chloro-1,3-benzothiazole |
| SMILES | [N-]=[N+]=NCC=Cc1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C10H7ClN4S/c11-10-14-8-4-3-7(6-9(8)16-10)2-1-5-13-15-12/h1-4,6H,5H2 |
| InChIKey | SRHJJJGOPXOMML-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|