C9H7F2NO2 — CID 131238479
(E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenamine (PubChem CID 131238479) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is (E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenamine.
| Compound Name | (E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenamine |
|---|---|
| PubChem CID | 131238479 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (E)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethenamine |
| SMILES | N/C=C/c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H7F2NO2/c10-9(11)13-7-2-1-6(3-4-12)5-8(7)14-9/h1-5H,12H2/b4-3+ |
| InChIKey | ZSNRLEUKAXSSRQ-ONEGZZNKSA-N |
| XLogP | 1.94 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |