C11H9F2NO3 — CID 144684060
(E)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylprop-2-enamide (PubChem CID 144684060) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is (E)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 144684060 |
| Molecular Formula | C11H9F2NO3 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (E)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C11H9F2NO3/c1-14-10(15)5-3-7-2-4-8-9(6-7)17-11(12,13)16-8/h2-6H,1H3,(H,14,15)/b5-3+ |
| InChIKey | VQLRLKLSKYHUOJ-HWKANZROSA-N |
| XLogP | 1.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|