C12H13F2NO2 — CID 117354591
1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopentan-1-amine (PubChem CID 117354591) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopentan-1-amine.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 117354591 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopentan-1-amine |
| SMILES | NC1(c2ccc3c(c2)OC(F)(F)O3)CCCC1 |
| InChI | InChI=1S/C12H13F2NO2/c13-12(14)16-9-4-3-8(7-10(9)17-12)11(15)5-1-2-6-11/h3-4,7H,1-2,5-6,15H2 |
| InChIKey | QQBPMFZHIBMKJS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |