C7H4F2O3 — CID 67356342
2,2-difluoro-1,3-benzodioxol-5-ol (PubChem CID 67356342) has the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. Its IUPAC name is 2,2-difluoro-1,3-benzodioxol-5-ol.
| Compound Name | 2,2-difluoro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 67356342 |
| Molecular Formula | C7H4F2O3 |
| Molecular Weight | 174.10 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 2,2-difluoro-1,3-benzodioxol-5-ol |
| SMILES | Oc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C7H4F2O3/c8-7(9)11-5-2-1-4(10)3-6(5)12-7/h1-3,10H |
| InChIKey | GEHVTOIGEVNIEQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.10 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |