C9H5F2NO4 — CID 116998331
2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetamide (PubChem CID 116998331) has the molecular formula C9H5F2NO4 and a molecular weight of 229.14 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetamide.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 116998331 |
| Molecular Formula | C9H5F2NO4 |
| Molecular Weight | 229.14 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H5F2NO4/c10-9(11)15-5-2-1-4(3-6(5)16-9)7(13)8(12)14/h1-3H,(H2,12,14) |
| InChIKey | WVPZGQKNSKGDPB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|