4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid

C11H8F2O5 — CID 116998299

IUPAC4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)c1ccc2c(c1)OC(F)(F)O2
InChIInChI=1S/C11H8F2O5/c12-11(13)17-8-3-1-6(5-9(8)18-11)7(14)2-4-10(15)16/h1,3,5H,2,4H2,(H,15,16)
InChIKeyGDMAUZFZMJBFKZ-UHFFFAOYSA-N
MW258.18 g/mol
LogP2.06
Rot. Bonds4

About 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid

4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid (PubChem CID 116998299) has the molecular formula C11H8F2O5 and a molecular weight of 258.18 g/mol. Its IUPAC name is 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid
PubChem CID116998299
Molecular FormulaC11H8F2O5
Molecular Weight258.18 g/mol
Exact Mass258.03
IUPAC Name4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)c1ccc2c(c1)OC(F)(F)O2
InChIInChI=1S/C11H8F2O5/c12-11(13)17-8-3-1-6(5-9(8)18-11)7(14)2-4-10(15)16/h1,3,5H,2,4H2,(H,15,16)
InChIKeyGDMAUZFZMJBFKZ-UHFFFAOYSA-N
XLogP2.06
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.18
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid?
The IUPAC name of 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid (CID 116998299) is 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid?
The canonical SMILES for 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid is O=C(O)CCC(=O)c1ccc2c(c1)OC(F)(F)O2.
What is the InChIKey of 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid?
The InChIKey is GDMAUZFZMJBFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2O5/c12-11(13)17-8-3-1-6(5-9(8)18-11)7(14)2-4-10(15)16/h1,3,5H,2,4H2,(H,15,16).
What are the key properties of 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid?
4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid has a molecular weight of 258.18 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid is sourced from PubChem (CID 116998299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).