C11H8F2O5 — CID 116998299
4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid (PubChem CID 116998299) has the molecular formula C11H8F2O5 and a molecular weight of 258.18 g/mol. Its IUPAC name is 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid.
| Compound Name | 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 116998299 |
| Molecular Formula | C11H8F2O5 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C11H8F2O5/c12-11(13)17-8-3-1-6(5-9(8)18-11)7(14)2-4-10(15)16/h1,3,5H,2,4H2,(H,15,16) |
| InChIKey | GDMAUZFZMJBFKZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |