C16H10F4N2O4 — CID 90363663
1-pyrimidin-4-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione (PubChem CID 90363663) has the molecular formula C16H10F4N2O4 and a molecular weight of 370.26 g/mol. Its IUPAC name is 1-pyrimidin-4-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione.
| Compound Name | 1-pyrimidin-4-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363663 |
| Molecular Formula | C16H10F4N2O4 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1-pyrimidin-4-yl-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccncn1)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C16H10F4N2O4/c17-15(18)16(19,20)26-14-7-9(1-4-13(14)25-15)11(23)2-3-12(24)10-5-6-21-8-22-10/h1,4-8H,2-3H2 |
| InChIKey | YAGXQVOKECVTQG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|