C19H14F4O5 — CID 78322272
1-(4-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione (PubChem CID 78322272) has the molecular formula C19H14F4O5 and a molecular weight of 398.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione.
| Compound Name | 1-(4-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 78322272 |
| Molecular Formula | C19H14F4O5 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)butane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)c2ccc3c(c2)OC(F)(F)C(F)(F)O3)cc1 |
| InChI | InChI=1S/C19H14F4O5/c1-26-13-5-2-11(3-6-13)14(24)7-8-15(25)12-4-9-16-17(10-12)28-19(22,23)18(20,21)27-16/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | QYQLHGMKVQPQBC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|