C16H6BrF5O4 — CID 87727954
1-(3-bromo-4-fluorophenyl)-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethane-1,2-dione (PubChem CID 87727954) has the molecular formula C16H6BrF5O4 and a molecular weight of 437.11 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethane-1,2-dione.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 87727954 |
| Molecular Formula | C16H6BrF5O4 |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccc2c(c1)OC(F)(F)C(F)(F)O2)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C16H6BrF5O4/c17-9-5-7(1-3-10(9)18)13(23)14(24)8-2-4-11-12(6-8)26-16(21,22)15(19,20)25-11/h1-6H |
| InChIKey | KDZLPSANPKIOCZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|