2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid

C9H4F2O5 — CID 117331845

IUPAC2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)c1ccc2c(c1)OC(F)(F)O2
InChIInChI=1S/C9H4F2O5/c10-9(11)15-5-2-1-4(3-6(5)16-9)7(12)8(13)14/h1-3H,(H,13,14)
InChIKeyCGSWBSHKZIHLTC-UHFFFAOYSA-N
MW230.12 g/mol
LogP1.28
Rot. Bonds2

About 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid

2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid (PubChem CID 117331845) has the molecular formula C9H4F2O5 and a molecular weight of 230.12 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid
PubChem CID117331845
Molecular FormulaC9H4F2O5
Molecular Weight230.12 g/mol
Exact Mass230.00
IUPAC Name2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)c1ccc2c(c1)OC(F)(F)O2
InChIInChI=1S/C9H4F2O5/c10-9(11)15-5-2-1-4(3-6(5)16-9)7(12)8(13)14/h1-3H,(H,13,14)
InChIKeyCGSWBSHKZIHLTC-UHFFFAOYSA-N
XLogP1.28
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.12
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
The IUPAC name of 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid (CID 117331845) is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid is O=C(O)C(=O)c1ccc2c(c1)OC(F)(F)O2.
What is the InChIKey of 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
The InChIKey is CGSWBSHKZIHLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F2O5/c10-9(11)15-5-2-1-4(3-6(5)16-9)7(12)8(13)14/h1-3H,(H,13,14).
What are the key properties of 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid?
2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid has a molecular weight of 230.12 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoacetic acid is sourced from PubChem (CID 117331845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).