C15H14F2O7 — CID 158592290
5-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione;methane (PubChem CID 158592290) has the molecular formula C15H14F2O7 and a molecular weight of 344.27 g/mol. Its IUPAC name is 5-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione;methane.
| Compound Name | 5-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione;methane |
|---|---|
| PubChem CID | 158592290 |
| Molecular Formula | C15H14F2O7 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione;methane |
| SMILES | C.CC1(C)OC(=O)C(C(=O)c2ccc3c(c2)OC(F)(F)O3)C(=O)O1 |
| InChI | InChI=1S/C14H10F2O7.CH4/c1-13(2)22-11(18)9(12(19)23-13)10(17)6-3-4-7-8(5-6)21-14(15,16)20-7;/h3-5,9H,1-2H3;1H4 |
| InChIKey | HUPBQPYATBFDOV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|