C12H9F2N3O3 — CID 126593249
trans-(1S,2S)-2-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-N-iminocyclopropane-1-carboximidamide (PubChem CID 126593249) has the molecular formula C12H9F2N3O3 and a molecular weight of 281.22 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-N-iminocyclopropane-1-carboximidamide.
| Compound Name | trans-(1S,2S)-2-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-N-iminocyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 126593249 |
| Molecular Formula | C12H9F2N3O3 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | trans-(1S,2S)-2-(2,2-difluoro-1,3-benzodioxole-5-carbonyl)-N-iminocyclopropane-1-carboximidamide |
| SMILES | [H]/N=C(\N=N\[H])[C@H]1C[C@@H]1C(=O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H9F2N3O3/c13-12(14)19-8-2-1-5(3-9(8)20-12)10(18)6-4-7(6)11(15)17-16/h1-3,6-7,15-16H,4H2/b15-11-,17-16+/t6-,7-/m0/s1 |
| InChIKey | NEEQVJPJMUFLGO-BIZMJPHVSA-N |
| XLogP | 2.84 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|