C15H15ClF2O3 — CID 134452715
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,2,3,3-tetramethylcyclopropane-1-carbonyl chloride (PubChem CID 134452715) has the molecular formula C15H15ClF2O3 and a molecular weight of 316.73 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,2,3,3-tetramethylcyclopropane-1-carbonyl chloride.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,2,3,3-tetramethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 134452715 |
| Molecular Formula | C15H15ClF2O3 |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,2,3,3-tetramethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(C)(C)C1(C(=O)Cl)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C15H15ClF2O3/c1-12(2)13(3,4)14(12,11(16)19)8-5-6-9-10(7-8)21-15(17,18)20-9/h5-7H,1-4H3 |
| InChIKey | CFNSJVHAINKZRC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|