C14H10F3NO3 — CID 103948200
2-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]-4-fluorophenol (PubChem CID 103948200) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]-4-fluorophenol.
| Compound Name | 2-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 103948200 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]-4-fluorophenol |
| SMILES | Oc1ccc(F)cc1CNc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C14H10F3NO3/c15-9-1-3-11(19)8(5-9)7-18-10-2-4-12-13(6-10)21-14(16,17)20-12/h1-6,18-19H,7H2 |
| InChIKey | ABFNISBCUSGEOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|