C12H9F2NO3 — CID 63204036
2,2-difluoro-N-(furan-3-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 63204036) has the molecular formula C12H9F2NO3 and a molecular weight of 253.20 g/mol. Its IUPAC name is 2,2-difluoro-N-(furan-3-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-(furan-3-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63204036 |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2,2-difluoro-N-(furan-3-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | FC1(F)Oc2ccc(NCc3ccoc3)cc2O1 |
| InChI | InChI=1S/C12H9F2NO3/c13-12(14)17-10-2-1-9(5-11(10)18-12)15-6-8-3-4-16-7-8/h1-5,7,15H,6H2 |
| InChIKey | MOXNJKGRZXRYCE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|