C11H9F2N3O3 — CID 103741999
2,2-difluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 103741999) has the molecular formula C11H9F2N3O3 and a molecular weight of 269.21 g/mol. Its IUPAC name is 2,2-difluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 103741999 |
| Molecular Formula | C11H9F2N3O3 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2,2-difluoro-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1nc(CNc2ccc3c(c2)OC(F)(F)O3)no1 |
| InChI | InChI=1S/C11H9F2N3O3/c1-6-15-10(16-19-6)5-14-7-2-3-8-9(4-7)18-11(12,13)17-8/h2-4,14H,5H2,1H3 |
| InChIKey | ICPOEXJZIBOZEU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|