C12H11F2N3O2 — CID 62743237
2,2-difluoro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 62743237) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 62743237 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2,2-difluoro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1ncc(CNc2ccc3c(c2)OC(F)(F)O3)[nH]1 |
| InChI | InChI=1S/C12H11F2N3O2/c1-7-15-5-9(17-7)6-16-8-2-3-10-11(4-8)19-12(13,14)18-10/h2-5,16H,6H2,1H3,(H,15,17) |
| InChIKey | LGQIWTHLJVGSGN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|