C15H16F2N2O2 — CID 66397523
2,2-difluoro-N-[(1-propylpyrrol-3-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 66397523) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2,2-difluoro-N-[(1-propylpyrrol-3-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[(1-propylpyrrol-3-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 66397523 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2,2-difluoro-N-[(1-propylpyrrol-3-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | CCCn1ccc(CNc2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C15H16F2N2O2/c1-2-6-19-7-5-11(10-19)9-18-12-3-4-13-14(8-12)21-15(16,17)20-13/h3-5,7-8,10,18H,2,6,9H2,1H3 |
| InChIKey | RNLONNGKCFTFAR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|