C16H10F4O6 — CID 158422752
2,2-difluoro-1,3-benzodioxole-5-carbaldehyde;(2,2-difluoro-1,3-benzodioxol-5-yl)methanol (PubChem CID 158422752) has the molecular formula C16H10F4O6 and a molecular weight of 374.24 g/mol. Its IUPAC name is 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde;(2,2-difluoro-1,3-benzodioxol-5-yl)methanol.
| Compound Name | 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde;(2,2-difluoro-1,3-benzodioxol-5-yl)methanol |
|---|---|
| PubChem CID | 158422752 |
| Molecular Formula | C16H10F4O6 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde;(2,2-difluoro-1,3-benzodioxol-5-yl)methanol |
| SMILES | O=Cc1ccc2c(c1)OC(F)(F)O2.OCc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C8H6F2O3.C8H4F2O3/c2*9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-3,11H,4H2;1-4H |
| InChIKey | HARKZNVMMRGHKO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|