C12H11F2NO3 — CID 139021208
N-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]prop-2-enamide (PubChem CID 139021208) has the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. Its IUPAC name is N-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]prop-2-enamide.
| Compound Name | N-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 139021208 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H11F2NO3/c1-2-11(16)15-6-5-8-3-4-9-10(7-8)18-12(13,14)17-9/h2-4,7H,1,5-6H2,(H,15,16) |
| InChIKey | BWHMDAKIUTULBV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|