C17H23NO3 — CID 159935899
tert-butyl 2-[4-[2-(prop-2-enoylamino)ethyl]phenyl]acetate (PubChem CID 159935899) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-(prop-2-enoylamino)ethyl]phenyl]acetate.
| Compound Name | tert-butyl 2-[4-[2-(prop-2-enoylamino)ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 159935899 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl 2-[4-[2-(prop-2-enoylamino)ethyl]phenyl]acetate |
| SMILES | C=CC(=O)NCCc1ccc(CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-5-15(19)18-11-10-13-6-8-14(9-7-13)12-16(20)21-17(2,3)4/h5-9H,1,10-12H2,2-4H3,(H,18,19) |
| InChIKey | KOSMTCIDXSYFQK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|