C15H22N2O3 — CID 175300118
methanol;N-(2-phenylethyl)prop-2-enamide;prop-2-enamide (PubChem CID 175300118) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is methanol;N-(2-phenylethyl)prop-2-enamide;prop-2-enamide.
| Compound Name | methanol;N-(2-phenylethyl)prop-2-enamide;prop-2-enamide |
|---|---|
| PubChem CID | 175300118 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | methanol;N-(2-phenylethyl)prop-2-enamide;prop-2-enamide |
| SMILES | C=CC(=O)NCCc1ccccc1.C=CC(N)=O.CO |
| InChI | InChI=1S/C11H13NO.C3H5NO.CH4O/c1-2-11(13)12-9-8-10-6-4-3-5-7-10;1-2-3(4)5;1-2/h2-7H,1,8-9H2,(H,12,13);2H,1H2,(H2,4,5);2H,1H3 |
| InChIKey | KQXVJTOOITXXMM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|