C18H27N2O3+ — CID 142238013
dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]-[3-(prop-2-enoylamino)propyl]azanium (PubChem CID 142238013) has the molecular formula C18H27N2O3+ and a molecular weight of 319.43 g/mol. Its IUPAC name is dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]-[3-(prop-2-enoylamino)propyl]azanium.
| Compound Name | dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]-[3-(prop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 142238013 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | dimethyl-[2-oxo-2-(2-phenylethoxy)ethyl]-[3-(prop-2-enoylamino)propyl]azanium |
| SMILES | C=CC(=O)NCCC[N+](C)(C)CC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c1-4-17(21)19-12-8-13-20(2,3)15-18(22)23-14-11-16-9-6-5-7-10-16/h4-7,9-10H,1,8,11-15H2,2-3H3/p+1 |
| InChIKey | ZUVKQPTXRSIVDV-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|