C20H37N2O3+ — CID 87991579
[2-(3,7-dimethyloct-6-enoxy)-2-oxoethyl]-dimethyl-[3-(prop-2-enoylamino)propyl]azanium (PubChem CID 87991579) has the molecular formula C20H37N2O3+ and a molecular weight of 353.53 g/mol. Its IUPAC name is [2-(3,7-dimethyloct-6-enoxy)-2-oxoethyl]-dimethyl-[3-(prop-2-enoylamino)propyl]azanium.
| Compound Name | [2-(3,7-dimethyloct-6-enoxy)-2-oxoethyl]-dimethyl-[3-(prop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 87991579 |
| Molecular Formula | C20H37N2O3+ |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | [2-(3,7-dimethyloct-6-enoxy)-2-oxoethyl]-dimethyl-[3-(prop-2-enoylamino)propyl]azanium |
| SMILES | C=CC(=O)NCCC[N+](C)(C)CC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H36N2O3/c1-7-19(23)21-13-9-14-22(5,6)16-20(24)25-15-12-18(4)11-8-10-17(2)3/h7,10,18H,1,8-9,11-16H2,2-6H3/p+1 |
| InChIKey | MTVCVZDJPRUDKG-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|