C22H40O3 — CID 166747683
[(3R)-3,7-dimethyloct-6-enyl] (5S)-3-hydroxy-5,9-dimethyldec-8-enoate (PubChem CID 166747683) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is [(3R)-3,7-dimethyloct-6-enyl] (5S)-3-hydroxy-5,9-dimethyldec-8-enoate.
| Compound Name | [(3R)-3,7-dimethyloct-6-enyl] (5S)-3-hydroxy-5,9-dimethyldec-8-enoate |
|---|---|
| PubChem CID | 166747683 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | [(3R)-3,7-dimethyloct-6-enyl] (5S)-3-hydroxy-5,9-dimethyldec-8-enoate |
| SMILES | CC(C)=CCC[C@@H](C)CCOC(=O)CC(O)C[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C22H40O3/c1-17(2)9-7-11-19(5)13-14-25-22(24)16-21(23)15-20(6)12-8-10-18(3)4/h9-10,19-21,23H,7-8,11-16H2,1-6H3/t19-,20+,21?/m1/s1 |
| InChIKey | SVLNBLVFFHFGII-PDYHCXRVSA-N |
| XLogP | 5.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|