C21H32O3 — CID 142486298
3,7-dimethyloct-6-enyl 4-(2-hydroxyphenyl)pentanoate (PubChem CID 142486298) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 4-(2-hydroxyphenyl)pentanoate.
| Compound Name | 3,7-dimethyloct-6-enyl 4-(2-hydroxyphenyl)pentanoate |
|---|---|
| PubChem CID | 142486298 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 4-(2-hydroxyphenyl)pentanoate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCC(C)c1ccccc1O |
| InChI | InChI=1S/C21H32O3/c1-16(2)8-7-9-17(3)14-15-24-21(23)13-12-18(4)19-10-5-6-11-20(19)22/h5-6,8,10-11,17-18,22H,7,9,12-15H2,1-4H3 |
| InChIKey | OLQHFWVWBRBWFK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|