C20H36O4 — CID 91713676
1-O-(3,7-dimethyloct-6-enyl) 6-O-(2-methylpropyl) hexanedioate (PubChem CID 91713676) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-O-(3,7-dimethyloct-6-enyl) 6-O-(2-methylpropyl) hexanedioate.
| Compound Name | 1-O-(3,7-dimethyloct-6-enyl) 6-O-(2-methylpropyl) hexanedioate |
|---|---|
| PubChem CID | 91713676 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 1-O-(3,7-dimethyloct-6-enyl) 6-O-(2-methylpropyl) hexanedioate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)CCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C20H36O4/c1-16(2)9-8-10-18(5)13-14-23-19(21)11-6-7-12-20(22)24-15-17(3)4/h9,17-18H,6-8,10-15H2,1-5H3 |
| InChIKey | PUYZMUIRNVXGCD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|